C36H32N4 — CID 89282091
10,11,13,14,16,18,20,23-octamethyl-1,22,31-triazanonacyclo[15.11.1.12,26.14,8.05,29.06,15.07,12.019,28.022,27]hentriaconta-2(30),3,5(29),6,8(31),9,11,13,15,17,19(28),20,24,26-tetradecaen-24-amine (PubChem CID 89282091) has the molecular formula C36H32N4 and a molecular weight of 520.68 g/mol. Its IUPAC name is 10,11,13,14,16,18,20,23-octamethyl-1,22,31-triazanonacyclo[15.11.1.12,26.14,8.05,29.06,15.07,12.019,28.022,27]hentriaconta-2(30),3,5(29),6,8(31),9,11,13,15,17,19(28),20,24,26-tetradecaen-24-amine.
| Compound Name | 10,11,13,14,16,18,20,23-octamethyl-1,22,31-triazanonacyclo[15.11.1.12,26.14,8.05,29.06,15.07,12.019,28.022,27]hentriaconta-2(30),3,5(29),6,8(31),9,11,13,15,17,19(28),20,24,26-tetradecaen-24-amine |
|---|---|
| PubChem CID | 89282091 |
| Molecular Formula | C36H32N4 |
| Molecular Weight | 520.68 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | 10,11,13,14,16,18,20,23-octamethyl-1,22,31-triazanonacyclo[15.11.1.12,26.14,8.05,29.06,15.07,12.019,28.022,27]hentriaconta-2(30),3,5(29),6,8(31),9,11,13,15,17,19(28),20,24,26-tetradecaen-24-amine |
| SMILES | Cc1cc2nc3cc4cc5c6c7c(c(C)cn6C(C)C(N)=C5)c(C)c5c(C)c6c(C)c(C)c(c1C)c2c6c3c5n47 |
| InChI | InChI=1S/C36H32N4/c1-14-9-25-31-28(16(14)3)17(4)18(5)29-20(7)30-19(6)27-15(2)13-39-21(8)24(37)11-22-10-23-12-26(38-25)32(33(29)31)35(30)40(23)36(27)34(22)39/h9-13,21H,37H2,1-8H3 |
| InChIKey | IXMWNSYIWPKRSP-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 48.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.68 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|