C40H50N4 — CID 154019367
N,N'-bis(2,2,6,6-tetramethylacridin-4-yl)hexane-1,6-diamine (PubChem CID 154019367) has the molecular formula C40H50N4 and a molecular weight of 586.87 g/mol. Its IUPAC name is N,N'-bis(2,2,6,6-tetramethylacridin-4-yl)hexane-1,6-diamine.
| Compound Name | N,N'-bis(2,2,6,6-tetramethylacridin-4-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 154019367 |
| Molecular Formula | C40H50N4 |
| Molecular Weight | 586.87 g/mol |
| Exact Mass | 586.40 |
| IUPAC Name | N,N'-bis(2,2,6,6-tetramethylacridin-4-yl)hexane-1,6-diamine |
| SMILES | CC1(C)C=C(NCCCCCCNC2=CC(C)(C)C=c3cc4c(nc32)=CC(C)(C)C=C4)c2nc3c(cc2=C1)C=CC(C)(C)C=3 |
| InChI | InChI=1S/C40H50N4/c1-37(2)15-13-27-19-29-21-39(5,6)25-33(35(29)43-31(27)23-37)41-17-11-9-10-12-18-42-34-26-40(7,8)22-30-20-28-14-16-38(3,4)24-32(28)44-36(30)34/h13-16,19-26,41-42H,9-12,17-18H2,1-8H3 |
| InChIKey | CSYOGHVSONOBMC-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.87 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|