C32H44N4 — CID 142952597
N'-[(Z)-(2-aminocyclohexen-1-yl)-(3-methylcyclohexa-2,4-dien-1-ylidene)methyl]-N-(7-methyl-1,2,3,4,10,10a-hexahydroacridin-9-yl)butane-1,4-diamine (PubChem CID 142952597) has the molecular formula C32H44N4 and a molecular weight of 484.73 g/mol. Its IUPAC name is N'-[(Z)-(2-aminocyclohexen-1-yl)-(3-methylcyclohexa-2,4-dien-1-ylidene)methyl]-N-(7-methyl-1,2,3,4,10,10a-hexahydroacridin-9-yl)butane-1,4-diamine.
| Compound Name | N'-[(Z)-(2-aminocyclohexen-1-yl)-(3-methylcyclohexa-2,4-dien-1-ylidene)methyl]-N-(7-methyl-1,2,3,4,10,10a-hexahydroacridin-9-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 142952597 |
| Molecular Formula | C32H44N4 |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | N'-[(Z)-(2-aminocyclohexen-1-yl)-(3-methylcyclohexa-2,4-dien-1-ylidene)methyl]-N-(7-methyl-1,2,3,4,10,10a-hexahydroacridin-9-yl)butane-1,4-diamine |
| SMILES | CC1=CC2=C(NCCCCN/C(C3=C(N)CCCC3)=C3\C=C(C)C=CC3)C3=C(CCCC3)NC2C=C1 |
| InChI | InChI=1S/C32H44N4/c1-22-10-9-11-24(20-22)31(25-12-3-5-14-28(25)33)34-18-7-8-19-35-32-26-13-4-6-15-29(26)36-30-17-16-23(2)21-27(30)32/h9-10,16-17,20-21,30,34-36H,3-8,11-15,18-19,33H2,1-2H3/b31-24- |
| InChIKey | OMVQISNTKDBXKQ-QLTSDVKISA-N |
| XLogP | 6.46 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|