C42H52N2 — CID 67951502
N-[(E)-5-(4-cyclohexa-2,4-dien-1-yl-1,7,8,8a-tetrahydronaphthalen-1-yl)-2-[3-(2,5-dihydro-1H-pyrrol-2-yl)cyclohexa-1,5-dien-1-yl]hex-4-enyl]-3,4,4a,5,6,8a-hexahydronaphthalen-2-amine (PubChem CID 67951502) has the molecular formula C42H52N2 and a molecular weight of 584.89 g/mol. Its IUPAC name is N-[(E)-5-(4-cyclohexa-2,4-dien-1-yl-1,7,8,8a-tetrahydronaphthalen-1-yl)-2-[3-(2,5-dihydro-1H-pyrrol-2-yl)cyclohexa-1,5-dien-1-yl]hex-4-enyl]-3,4,4a,5,6,8a-hexahydronaphthalen-2-amine.
| Compound Name | N-[(E)-5-(4-cyclohexa-2,4-dien-1-yl-1,7,8,8a-tetrahydronaphthalen-1-yl)-2-[3-(2,5-dihydro-1H-pyrrol-2-yl)cyclohexa-1,5-dien-1-yl]hex-4-enyl]-3,4,4a,5,6,8a-hexahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 67951502 |
| Molecular Formula | C42H52N2 |
| Molecular Weight | 584.89 g/mol |
| Exact Mass | 584.41 |
| IUPAC Name | N-[(E)-5-(4-cyclohexa-2,4-dien-1-yl-1,7,8,8a-tetrahydronaphthalen-1-yl)-2-[3-(2,5-dihydro-1H-pyrrol-2-yl)cyclohexa-1,5-dien-1-yl]hex-4-enyl]-3,4,4a,5,6,8a-hexahydronaphthalen-2-amine |
| SMILES | C/C(=C\CC(CNC1=CC2C=CCCC2CC1)C1=CC(C2C=CCN2)CC=C1)C1C=CC(C2C=CC=CC2)=C2C=CCCC21 |
| InChI | InChI=1S/C42H52N2/c1-30(38-24-25-39(32-12-3-2-4-13-32)41-18-8-7-17-40(38)41)20-21-36(33-15-9-16-35(27-33)42-19-10-26-43-42)29-44-37-23-22-31-11-5-6-14-34(31)28-37/h2-4,6,8-10,12,14-15,18-20,24-25,27-28,31-32,34-36,38,40,42-44H,5,7,11,13,16-17,21-23,26,29H2,1H3/b30-20+ |
| InChIKey | RDBAWDYLTMVMMY-TWKHWXDSSA-N |
| XLogP | 9.40 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.89 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|