C42H51FN2 — CID 89531102
N-(3-cyclohexa-1,5-dien-1-ylcyclohex-3-en-1-yl)-9-[4-[2-(1-fluoroethyl)-3,4,4a,8a-tetrahydronaphthalen-1-yl]cyclohexen-1-yl]-4,4a,4b,5,8,8a-hexahydrocarbazol-4-amine (PubChem CID 89531102) has the molecular formula C42H51FN2 and a molecular weight of 602.90 g/mol. Its IUPAC name is N-(3-cyclohexa-1,5-dien-1-ylcyclohex-3-en-1-yl)-9-[4-[2-(1-fluoroethyl)-3,4,4a,8a-tetrahydronaphthalen-1-yl]cyclohexen-1-yl]-4,4a,4b,5,8,8a-hexahydrocarbazol-4-amine.
| Compound Name | N-(3-cyclohexa-1,5-dien-1-ylcyclohex-3-en-1-yl)-9-[4-[2-(1-fluoroethyl)-3,4,4a,8a-tetrahydronaphthalen-1-yl]cyclohexen-1-yl]-4,4a,4b,5,8,8a-hexahydrocarbazol-4-amine |
|---|---|
| PubChem CID | 89531102 |
| Molecular Formula | C42H51FN2 |
| Molecular Weight | 602.90 g/mol |
| Exact Mass | 602.40 |
| IUPAC Name | N-(3-cyclohexa-1,5-dien-1-ylcyclohex-3-en-1-yl)-9-[4-[2-(1-fluoroethyl)-3,4,4a,8a-tetrahydronaphthalen-1-yl]cyclohexen-1-yl]-4,4a,4b,5,8,8a-hexahydrocarbazol-4-amine |
| SMILES | CC(C1=C(C2C=CC=CC2CC1)C3CCC(=CC3)N4C5CC=CCC5C6C4=CC=CC6NC7CCC=C(C7)C8=CCCC=C8)F |
| InChI | InChI=1S/C42H51FN2/c1-28(43)35-26-23-30-13-5-6-16-36(30)41(35)31-21-24-34(25-22-31)45-39-19-8-7-17-37(39)42-38(18-10-20-40(42)45)44-33-15-9-14-32(27-33)29-11-3-2-4-12-29/h3,5-8,10-14,16,18,20,24,28,30-31,33,36-39,42,44H,2,4,9,15,17,19,21-23,25-27H2,1H3 |
| InChIKey | CVAGLHFXHWHFAQ-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 15.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | 1480 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.90 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|