C26H21NO4 — CID 8928245
2-(4-benzoylphenoxy)-N-[(R)-furan-2-yl(phenyl)methyl]acetamide (PubChem CID 8928245) has the molecular formula C26H21NO4 and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-(4-benzoylphenoxy)-N-[(R)-furan-2-yl(phenyl)methyl]acetamide.
| Compound Name | 2-(4-benzoylphenoxy)-N-[(R)-furan-2-yl(phenyl)methyl]acetamide |
|---|---|
| PubChem CID | 8928245 |
| Molecular Formula | C26H21NO4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 2-(4-benzoylphenoxy)-N-[(R)-furan-2-yl(phenyl)methyl]acetamide |
| SMILES | O=C(COc1ccc(C(=O)c2ccccc2)cc1)N[C@H](c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C26H21NO4/c28-24(27-25(23-12-7-17-30-23)19-8-3-1-4-9-19)18-31-22-15-13-21(14-16-22)26(29)20-10-5-2-6-11-20/h1-17,25H,18H2,(H,27,28)/t25-/m1/s1 |
| InChIKey | RZBPUXTZZVWVBL-RUZDIDTESA-N |
| XLogP | 4.80 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |