C20H16FNO4 — CID 41259204
[2-[[(S)-furan-2-yl(phenyl)methyl]amino]-2-oxoethyl] 4-fluorobenzoate (PubChem CID 41259204) has the molecular formula C20H16FNO4 and a molecular weight of 353.35 g/mol. Its IUPAC name is [2-[[(S)-furan-2-yl(phenyl)methyl]amino]-2-oxoethyl] 4-fluorobenzoate.
| Compound Name | [2-[[(S)-furan-2-yl(phenyl)methyl]amino]-2-oxoethyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 41259204 |
| Molecular Formula | C20H16FNO4 |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | [2-[[(S)-furan-2-yl(phenyl)methyl]amino]-2-oxoethyl] 4-fluorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(F)cc1)N[C@@H](c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C20H16FNO4/c21-16-10-8-15(9-11-16)20(24)26-13-18(23)22-19(17-7-4-12-25-17)14-5-2-1-3-6-14/h1-12,19H,13H2,(H,22,23)/t19-/m0/s1 |
| InChIKey | OXPYMCCGTPMLNQ-IBGZPJMESA-N |
| XLogP | 3.48 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |