C16H27NO3S2 — CID 89286143
1-cyclohexylsulfonyl-N-(2-prop-1-en-2-ylsulfanylethyl)cyclobutane-1-carboxamide (PubChem CID 89286143) has the molecular formula C16H27NO3S2 and a molecular weight of 345.53 g/mol. Its IUPAC name is 1-cyclohexylsulfonyl-N-(2-prop-1-en-2-ylsulfanylethyl)cyclobutane-1-carboxamide.
| Compound Name | 1-cyclohexylsulfonyl-N-(2-prop-1-en-2-ylsulfanylethyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 89286143 |
| Molecular Formula | C16H27NO3S2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 1-cyclohexylsulfonyl-N-(2-prop-1-en-2-ylsulfanylethyl)cyclobutane-1-carboxamide |
| SMILES | C=C(C)SCCNC(=O)C1(S(=O)(=O)C2CCCCC2)CCC1 |
| InChI | InChI=1S/C16H27NO3S2/c1-13(2)21-12-11-17-15(18)16(9-6-10-16)22(19,20)14-7-4-3-5-8-14/h14H,1,3-12H2,2H3,(H,17,18) |
| InChIKey | LRGDGNKWRSKLQP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|