C27H26N4O4 — CID 89288247
2-amino-4-oxo-2-[4-(3-pyridazin-4-ylbenzoyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]butanoic acid (PubChem CID 89288247) has the molecular formula C27H26N4O4 and a molecular weight of 470.53 g/mol. Its IUPAC name is 2-amino-4-oxo-2-[4-(3-pyridazin-4-ylbenzoyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]butanoic acid.
| Compound Name | 2-amino-4-oxo-2-[4-(3-pyridazin-4-ylbenzoyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]butanoic acid |
|---|---|
| PubChem CID | 89288247 |
| Molecular Formula | C27H26N4O4 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 2-amino-4-oxo-2-[4-(3-pyridazin-4-ylbenzoyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]butanoic acid |
| SMILES | NC(CC=O)(C(=O)O)C1c2ccccc2N(C(=O)c2cccc(-c3ccnnc3)c2)C2CCCC21 |
| InChI | InChI=1S/C27H26N4O4/c28-27(12-14-32,26(34)35)24-20-7-1-2-9-22(20)31(23-10-4-8-21(23)24)25(33)18-6-3-5-17(15-18)19-11-13-29-30-16-19/h1-3,5-7,9,11,13-16,21,23-24H,4,8,10,12,28H2,(H,34,35) |
| InChIKey | BAVHSGSAEGMOMB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|