C21H18INO6 — CID 89289902
benzyl 5-formyl-3-iodo-1-[(4-methoxyphenyl)methyl]-2,4-dioxopyrrolidine-3-carboxylate (PubChem CID 89289902) has the molecular formula C21H18INO6 and a molecular weight of 507.28 g/mol. Its IUPAC name is benzyl 5-formyl-3-iodo-1-[(4-methoxyphenyl)methyl]-2,4-dioxopyrrolidine-3-carboxylate.
| Compound Name | benzyl 5-formyl-3-iodo-1-[(4-methoxyphenyl)methyl]-2,4-dioxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 89289902 |
| Molecular Formula | C21H18INO6 |
| Molecular Weight | 507.28 g/mol |
| Exact Mass | 507.02 |
| IUPAC Name | benzyl 5-formyl-3-iodo-1-[(4-methoxyphenyl)methyl]-2,4-dioxopyrrolidine-3-carboxylate |
| SMILES | COc1ccc(CN2C(=O)C(I)(C(=O)OCc3ccccc3)C(=O)C2C=O)cc1 |
| InChI | InChI=1S/C21H18INO6/c1-28-16-9-7-14(8-10-16)11-23-17(12-24)18(25)21(22,19(23)26)20(27)29-13-15-5-3-2-4-6-15/h2-10,12,17H,11,13H2,1H3 |
| InChIKey | AGQAQUWAJNPVSW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|