C19H18BrN3O3 — CID 89291052
5-bromo-8-hydroxy-N-[2-(3-methoxyphenyl)propan-2-yl]-1,6-naphthyridine-7-carboxamide (PubChem CID 89291052) has the molecular formula C19H18BrN3O3 and a molecular weight of 416.28 g/mol. Its IUPAC name is 5-bromo-8-hydroxy-N-[2-(3-methoxyphenyl)propan-2-yl]-1,6-naphthyridine-7-carboxamide.
| Compound Name | 5-bromo-8-hydroxy-N-[2-(3-methoxyphenyl)propan-2-yl]-1,6-naphthyridine-7-carboxamide |
|---|---|
| PubChem CID | 89291052 |
| Molecular Formula | C19H18BrN3O3 |
| Molecular Weight | 416.28 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 5-bromo-8-hydroxy-N-[2-(3-methoxyphenyl)propan-2-yl]-1,6-naphthyridine-7-carboxamide |
| SMILES | COc1cccc(C(C)(C)NC(=O)c2nc(Br)c3cccnc3c2O)c1 |
| InChI | InChI=1S/C19H18BrN3O3/c1-19(2,11-6-4-7-12(10-11)26-3)23-18(25)15-16(24)14-13(17(20)22-15)8-5-9-21-14/h4-10,24H,1-3H3,(H,23,25) |
| InChIKey | RPCYASPYKGJTRL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.28 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|