C24H23N3O7S3 — CID 89292273
[1-(benzenesulfonyl)-4-(4-pyrrolidin-1-ylsulfonylphenyl)pyrrolo[2,3-b]pyridin-2-yl]methyl hydrogen sulfite (PubChem CID 89292273) has the molecular formula C24H23N3O7S3 and a molecular weight of 561.66 g/mol. Its IUPAC name is [1-(benzenesulfonyl)-4-(4-pyrrolidin-1-ylsulfonylphenyl)pyrrolo[2,3-b]pyridin-2-yl]methyl hydrogen sulfite.
| Compound Name | [1-(benzenesulfonyl)-4-(4-pyrrolidin-1-ylsulfonylphenyl)pyrrolo[2,3-b]pyridin-2-yl]methyl hydrogen sulfite |
|---|---|
| PubChem CID | 89292273 |
| Molecular Formula | C24H23N3O7S3 |
| Molecular Weight | 561.66 g/mol |
| Exact Mass | 561.07 |
| IUPAC Name | [1-(benzenesulfonyl)-4-(4-pyrrolidin-1-ylsulfonylphenyl)pyrrolo[2,3-b]pyridin-2-yl]methyl hydrogen sulfite |
| SMILES | O=S(O)OCc1cc2c(-c3ccc(S(=O)(=O)N4CCCC4)cc3)ccnc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H23N3O7S3/c28-35(29)34-17-19-16-23-22(18-8-10-21(11-9-18)36(30,31)26-14-4-5-15-26)12-13-25-24(23)27(19)37(32,33)20-6-2-1-3-7-20/h1-3,6-13,16H,4-5,14-15,17H2,(H,28,29) |
| InChIKey | OPVFSFIAQMTIJJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.66 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|