C20H27F2N7O3 — CID 89292567
2-[3-[(2,2-difluoro-2-phenylethyl)amino]-6-methyl-2-oxopyrazin-1-yl]-N-[2-[(N,N'-dimethylcarbamimidoyl)amino]oxyethyl]acetamide (PubChem CID 89292567) has the molecular formula C20H27F2N7O3 and a molecular weight of 451.48 g/mol. Its IUPAC name is 2-[3-[(2,2-difluoro-2-phenylethyl)amino]-6-methyl-2-oxopyrazin-1-yl]-N-[2-[(N,N'-dimethylcarbamimidoyl)amino]oxyethyl]acetamide.
| Compound Name | 2-[3-[(2,2-difluoro-2-phenylethyl)amino]-6-methyl-2-oxopyrazin-1-yl]-N-[2-[(N,N'-dimethylcarbamimidoyl)amino]oxyethyl]acetamide |
|---|---|
| PubChem CID | 89292567 |
| Molecular Formula | C20H27F2N7O3 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 2-[3-[(2,2-difluoro-2-phenylethyl)amino]-6-methyl-2-oxopyrazin-1-yl]-N-[2-[(N,N'-dimethylcarbamimidoyl)amino]oxyethyl]acetamide |
| SMILES | C/N=C(\NC)NOCCNC(=O)Cn1c(C)cnc(NCC(F)(F)c2ccccc2)c1=O |
| InChI | InChI=1S/C20H27F2N7O3/c1-14-11-26-17(27-13-20(21,22)15-7-5-4-6-8-15)18(31)29(14)12-16(30)25-9-10-32-28-19(23-2)24-3/h4-8,11H,9-10,12-13H2,1-3H3,(H,25,30)(H,26,27)(H2,23,24,28) |
| InChIKey | QKAJVBLMDSPNON-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 121.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|