C17H20N4O2 — CID 89293960
3-amino-5-[1-(2,2-dimethylpropanoyl)-3,5-dimethylpyrazol-4-yl]oxybenzonitrile (PubChem CID 89293960) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 3-amino-5-[1-(2,2-dimethylpropanoyl)-3,5-dimethylpyrazol-4-yl]oxybenzonitrile.
| Compound Name | 3-amino-5-[1-(2,2-dimethylpropanoyl)-3,5-dimethylpyrazol-4-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 89293960 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3-amino-5-[1-(2,2-dimethylpropanoyl)-3,5-dimethylpyrazol-4-yl]oxybenzonitrile |
| SMILES | Cc1nn(C(=O)C(C)(C)C)c(C)c1Oc1cc(N)cc(C#N)c1 |
| InChI | InChI=1S/C17H20N4O2/c1-10-15(11(2)21(20-10)16(22)17(3,4)5)23-14-7-12(9-18)6-13(19)8-14/h6-8H,19H2,1-5H3 |
| InChIKey | FBSDRGVOXUUBHD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 93.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|