C66H42N8 — CID 89296040
9-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-[3-[3-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-1-yl]phenyl]phenyl]carbazole (PubChem CID 89296040) has the molecular formula C66H42N8 and a molecular weight of 947.12 g/mol. Its IUPAC name is 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-[3-[3-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-1-yl]phenyl]phenyl]carbazole.
| Compound Name | 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-[3-[3-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-1-yl]phenyl]phenyl]carbazole |
|---|---|
| PubChem CID | 89296040 |
| Molecular Formula | C66H42N8 |
| Molecular Weight | 947.12 g/mol |
| Exact Mass | 946.35 |
| IUPAC Name | 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-[3-[3-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazol-1-yl]phenyl]phenyl]carbazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-n3c4ccccc4c4cccc(-c5cccc(-c6cccc(-c7cccc8c9ccccc9n(-c9nc(-c%10ccccc%10)nc(-c%10ccccc%10)n9)c78)c6)c5)c43)n2)cc1 |
| InChI | InChI=1S/C66H42N8/c1-5-21-43(22-6-1)61-67-62(44-23-7-2-8-24-44)70-65(69-61)73-57-39-15-13-33-53(57)55-37-19-35-51(59(55)73)49-31-17-29-47(41-49)48-30-18-32-50(42-48)52-36-20-38-56-54-34-14-16-40-58(54)74(60(52)56)66-71-63(45-25-9-3-10-26-45)68-64(72-66)46-27-11-4-12-28-46/h1-42H |
| InChIKey | QWOQFKZRNMBOHX-UHFFFAOYSA-N |
| XLogP | 15.92 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.12 |
| LogP ≤ 5 | 15.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |