C23H22ClNO2 — CID 89298283
2-chloro-5,6-dimethoxy-1-[(4-phenylphenyl)methyl]-1,3-dihydroisoindole (PubChem CID 89298283) has the molecular formula C23H22ClNO2 and a molecular weight of 379.89 g/mol. Its IUPAC name is 2-chloro-5,6-dimethoxy-1-[(4-phenylphenyl)methyl]-1,3-dihydroisoindole.
| Compound Name | 2-chloro-5,6-dimethoxy-1-[(4-phenylphenyl)methyl]-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 89298283 |
| Molecular Formula | C23H22ClNO2 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 2-chloro-5,6-dimethoxy-1-[(4-phenylphenyl)methyl]-1,3-dihydroisoindole |
| SMILES | COc1cc2c(cc1OC)C(Cc1ccc(-c3ccccc3)cc1)N(Cl)C2 |
| InChI | InChI=1S/C23H22ClNO2/c1-26-22-13-19-15-25(24)21(20(19)14-23(22)27-2)12-16-8-10-18(11-9-16)17-6-4-3-5-7-17/h3-11,13-14,21H,12,15H2,1-2H3 |
| InChIKey | ORQIVSVYFHDWTN-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|