C28H33N5O2 — CID 89299444
N-[4-[6-[2-(cyclobutylmethyl)but-3-enoylamino]-3H-imidazo[4,5-c]pyridin-2-yl]phenyl]cyclohexanecarboxamide (PubChem CID 89299444) has the molecular formula C28H33N5O2 and a molecular weight of 471.61 g/mol. Its IUPAC name is N-[4-[6-[2-(cyclobutylmethyl)but-3-enoylamino]-3H-imidazo[4,5-c]pyridin-2-yl]phenyl]cyclohexanecarboxamide.
| Compound Name | N-[4-[6-[2-(cyclobutylmethyl)but-3-enoylamino]-3H-imidazo[4,5-c]pyridin-2-yl]phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 89299444 |
| Molecular Formula | C28H33N5O2 |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | N-[4-[6-[2-(cyclobutylmethyl)but-3-enoylamino]-3H-imidazo[4,5-c]pyridin-2-yl]phenyl]cyclohexanecarboxamide |
| SMILES | C=CC(CC1CCC1)C(=O)Nc1cc2nc(-c3ccc(NC(=O)C4CCCCC4)cc3)[nH]c2cn1 |
| InChI | InChI=1S/C28H33N5O2/c1-2-19(15-18-7-6-8-18)27(34)33-25-16-23-24(17-29-25)32-26(31-23)20-11-13-22(14-12-20)30-28(35)21-9-4-3-5-10-21/h2,11-14,16-19,21H,1,3-10,15H2,(H,30,35)(H,31,32)(H,29,33,34) |
| InChIKey | RPOUPSMOXPPYQQ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|