C13H17N3O2S — CID 89299886
[(2R)-2-amino-3-[(R)-hydroxy(pyridin-4-yl)methyl]thiiran-2-yl]-pyrrolidin-1-ylmethanone (PubChem CID 89299886) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is [(2R)-2-amino-3-[(R)-hydroxy(pyridin-4-yl)methyl]thiiran-2-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(2R)-2-amino-3-[(R)-hydroxy(pyridin-4-yl)methyl]thiiran-2-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 89299886 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | [(2R)-2-amino-3-[(R)-hydroxy(pyridin-4-yl)methyl]thiiran-2-yl]-pyrrolidin-1-ylmethanone |
| SMILES | N[C@]1(C(=O)N2CCCC2)SC1[C@H](O)c1ccncc1 |
| InChI | InChI=1S/C13H17N3O2S/c14-13(12(18)16-7-1-2-8-16)11(19-13)10(17)9-3-5-15-6-4-9/h3-6,10-11,17H,1-2,7-8,14H2/t10-,11?,13+/m1/s1 |
| InChIKey | WPOFWIHHINXDAO-XEEJXUNPSA-N |
| XLogP | 0.51 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|