C18H26FN3OS — CID 89302994
2-[[(E)-3-(aminomethyl)-6-fluoro-2-methylidene-1-(prop-1-en-2-ylamino)hept-5-enyl]sulfanylmethyl]pyridin-3-ol (PubChem CID 89302994) has the molecular formula C18H26FN3OS and a molecular weight of 351.49 g/mol. Its IUPAC name is 2-[[(E)-3-(aminomethyl)-6-fluoro-2-methylidene-1-(prop-1-en-2-ylamino)hept-5-enyl]sulfanylmethyl]pyridin-3-ol.
| Compound Name | 2-[[(E)-3-(aminomethyl)-6-fluoro-2-methylidene-1-(prop-1-en-2-ylamino)hept-5-enyl]sulfanylmethyl]pyridin-3-ol |
|---|---|
| PubChem CID | 89302994 |
| Molecular Formula | C18H26FN3OS |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 2-[[(E)-3-(aminomethyl)-6-fluoro-2-methylidene-1-(prop-1-en-2-ylamino)hept-5-enyl]sulfanylmethyl]pyridin-3-ol |
| SMILES | C=C(C)NC(SCc1ncccc1O)C(=C)C(CN)C/C=C(\C)F |
| InChI | InChI=1S/C18H26FN3OS/c1-12(2)22-18(14(4)15(10-20)8-7-13(3)19)24-11-16-17(23)6-5-9-21-16/h5-7,9,15,18,22-23H,1,4,8,10-11,20H2,2-3H3/b13-7+ |
| InChIKey | OGRFUCIUWLOROK-NTUHNPAUSA-N |
| XLogP | 3.86 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|