C26H29FN2O6 — CID 89305981
N-[(2S)-3-cyclohexyl-1-[[(3S)-2-(oxiran-2-yl)-5-oxooxolan-3-yl]amino]-1-oxopropan-2-yl]-5-(3-fluorophenyl)furan-2-carboxamide (PubChem CID 89305981) has the molecular formula C26H29FN2O6 and a molecular weight of 484.52 g/mol. Its IUPAC name is N-[(2S)-3-cyclohexyl-1-[[(3S)-2-(oxiran-2-yl)-5-oxooxolan-3-yl]amino]-1-oxopropan-2-yl]-5-(3-fluorophenyl)furan-2-carboxamide.
| Compound Name | N-[(2S)-3-cyclohexyl-1-[[(3S)-2-(oxiran-2-yl)-5-oxooxolan-3-yl]amino]-1-oxopropan-2-yl]-5-(3-fluorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 89305981 |
| Molecular Formula | C26H29FN2O6 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | N-[(2S)-3-cyclohexyl-1-[[(3S)-2-(oxiran-2-yl)-5-oxooxolan-3-yl]amino]-1-oxopropan-2-yl]-5-(3-fluorophenyl)furan-2-carboxamide |
| SMILES | O=C1C[C@H](NC(=O)[C@H](CC2CCCCC2)NC(=O)c2ccc(-c3cccc(F)c3)o2)C(C2CO2)O1 |
| InChI | InChI=1S/C26H29FN2O6/c27-17-8-4-7-16(12-17)20-9-10-21(34-20)26(32)29-19(11-15-5-2-1-3-6-15)25(31)28-18-13-23(30)35-24(18)22-14-33-22/h4,7-10,12,15,18-19,22,24H,1-3,5-6,11,13-14H2,(H,28,31)(H,29,32)/t18-,19-,22?,24?/m0/s1 |
| InChIKey | MVQHPYHOKXTSLY-PLUPDXBSSA-N |
| XLogP | 3.35 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|