C15H19ClN4O2S2 — CID 89306621
3-[(6-chloropyrimidin-4-yl)amino]-N-methyl-4-(2-methylpropylsulfanyl)benzenesulfonamide (PubChem CID 89306621) has the molecular formula C15H19ClN4O2S2 and a molecular weight of 386.93 g/mol. Its IUPAC name is 3-[(6-chloropyrimidin-4-yl)amino]-N-methyl-4-(2-methylpropylsulfanyl)benzenesulfonamide.
| Compound Name | 3-[(6-chloropyrimidin-4-yl)amino]-N-methyl-4-(2-methylpropylsulfanyl)benzenesulfonamide |
|---|---|
| PubChem CID | 89306621 |
| Molecular Formula | C15H19ClN4O2S2 |
| Molecular Weight | 386.93 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 3-[(6-chloropyrimidin-4-yl)amino]-N-methyl-4-(2-methylpropylsulfanyl)benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(SCC(C)C)c(Nc2cc(Cl)ncn2)c1 |
| InChI | InChI=1S/C15H19ClN4O2S2/c1-10(2)8-23-13-5-4-11(24(21,22)17-3)6-12(13)20-15-7-14(16)18-9-19-15/h4-7,9-10,17H,8H2,1-3H3,(H,18,19,20) |
| InChIKey | XBYHBSFVPSSHCI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.93 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |