C33H20N2 — CID 89309386
9,16-Bis(2,3,4,5,6-pentadeuteriophenyl)-4,9-diazahexacyclo[13.6.2.02,10.03,8.012,22.019,23]tricosa-1(22),2(10),3(8),4,6,11,13,15,17,19(23),20-undecaene (PubChem CID 89309386) has the molecular formula C33H20N2 and a molecular weight of 454.60 g/mol. Its IUPAC name is 9,16-bis(2,3,4,5,6-pentadeuteriophenyl)-4,9-diazahexacyclo[13.6.2.02,10.03,8.012,22.019,23]tricosa-1(22),2(10),3(8),4,6,11,13,15,17,19(23),20-undecaene.
| Compound Name | 9,16-Bis(2,3,4,5,6-pentadeuteriophenyl)-4,9-diazahexacyclo[13.6.2.02,10.03,8.012,22.019,23]tricosa-1(22),2(10),3(8),4,6,11,13,15,17,19(23),20-undecaene |
|---|---|
| PubChem CID | 89309386 |
| Molecular Formula | C33H20N2 |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 9,16-bis(2,3,4,5,6-pentadeuteriophenyl)-4,9-diazahexacyclo[13.6.2.02,10.03,8.012,22.019,23]tricosa-1(22),2(10),3(8),4,6,11,13,15,17,19(23),20-undecaene |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=C3C=CC4=CC5=C(C6=C4C3=C(C=C2)C=C6)C7=C(N5C8=C(C(=C(C(=C8[2H])[2H])[2H])[2H])[2H])C=CC=N7)[2H])[2H] |
| InChI | InChI=1S/C33H20N2/c1-3-8-21(9-4-1)25-16-13-22-14-18-27-31-23(15-17-26(25)30(22)31)20-29-32(27)33-28(12-7-19-34-33)35(29)24-10-5-2-6-11-24/h1-20H/i1D,2D,3D,4D,5D,6D,8D,9D,10D,11D |
| InChIKey | SRCMIAGIZGVWDV-RYDBCNKQSA-N |
| XLogP | 8.80 |
| TPSA | 17.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | 752 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|