C46H30N2 — CID 89341650
4-[3-(2,3,4,5,6-pentadeuteriophenyl)-3-azahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2(10),4,6,8,11,13,15,17,19(23),20-undecaen-16-yl]-N,N-diphenylaniline (PubChem CID 89341650) has the molecular formula C46H30N2 and a molecular weight of 615.79 g/mol. Its IUPAC name is 4-[3-(2,3,4,5,6-pentadeuteriophenyl)-3-azahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2(10),4,6,8,11,13,15,17,19(23),20-undecaen-16-yl]-N,N-diphenylaniline.
| Compound Name | 4-[3-(2,3,4,5,6-pentadeuteriophenyl)-3-azahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2(10),4,6,8,11,13,15,17,19(23),20-undecaen-16-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 89341650 |
| Molecular Formula | C46H30N2 |
| Molecular Weight | 615.79 g/mol |
| Exact Mass | 615.27 |
| IUPAC Name | 4-[3-(2,3,4,5,6-pentadeuteriophenyl)-3-azahexacyclo[13.6.2.02,10.04,9.012,22.019,23]tricosa-1(22),2(10),4,6,8,11,13,15,17,19(23),20-undecaen-16-yl]-N,N-diphenylaniline |
| SMILES | [2H]c1c([2H])c([2H])c(-n2c3ccccc3c3cc4ccc5c(-c6ccc(N(c7ccccc7)c7ccccc7)cc6)ccc6ccc(c4c65)c32)c([2H])c1[2H] |
| InChI | InChI=1S/C46H30N2/c1-4-12-34(13-5-1)47(35-14-6-2-7-15-35)37-25-20-31(21-26-37)38-27-22-32-23-29-41-45-33(24-28-40(38)44(32)45)30-42-39-18-10-11-19-43(39)48(46(41)42)36-16-8-3-9-17-36/h1-30H/i3D,8D,9D,16D,17D |
| InChIKey | AANZMYGKWZRXLR-VRDWFHIRSA-N |
| XLogP | 12.82 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.79 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|