C48H33N3 — CID 90126241
2,3,4,5,6-pentadeuterio-N-[4-(11,12-diphenylindolo[2,3-a]carbazol-5-yl)phenyl]-N-phenylaniline (PubChem CID 90126241) has the molecular formula C48H33N3 and a molecular weight of 656.84 g/mol. Its IUPAC name is 2,3,4,5,6-pentadeuterio-N-[4-(11,12-diphenylindolo[2,3-a]carbazol-5-yl)phenyl]-N-phenylaniline.
| Compound Name | 2,3,4,5,6-pentadeuterio-N-[4-(11,12-diphenylindolo[2,3-a]carbazol-5-yl)phenyl]-N-phenylaniline |
|---|---|
| PubChem CID | 90126241 |
| Molecular Formula | C48H33N3 |
| Molecular Weight | 656.84 g/mol |
| Exact Mass | 656.30 |
| IUPAC Name | 2,3,4,5,6-pentadeuterio-N-[4-(11,12-diphenylindolo[2,3-a]carbazol-5-yl)phenyl]-N-phenylaniline |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2ccccc2)c2ccc(-c3cc4c5ccccc5n(-c5ccccc5)c4c4c3c3ccccc3n4-c3ccccc3)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C48H33N3/c1-5-17-35(18-6-1)49(36-19-7-2-8-20-36)39-31-29-34(30-32-39)42-33-43-40-25-13-15-27-44(40)50(37-21-9-3-10-22-37)47(43)48-46(42)41-26-14-16-28-45(41)51(48)38-23-11-4-12-24-38/h1-33H/i1D,5D,6D,17D,18D |
| InChIKey | VLYIVQDVMJGLPW-WCEQKODJSA-N |
| XLogP | 13.02 |
| TPSA | 13.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.84 |
| LogP ≤ 5 | 13.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |