C22H13F6N3O — CID 89310412
2-cyano-N-[[4-(trifluoromethyl)phenyl]-[3-(trifluoromethyl)-2-pyridinyl]methyl]benzamide (PubChem CID 89310412) has the molecular formula C22H13F6N3O and a molecular weight of 449.35 g/mol. Its IUPAC name is 2-cyano-N-[[4-(trifluoromethyl)phenyl]-[3-(trifluoromethyl)-2-pyridinyl]methyl]benzamide.
| Compound Name | 2-cyano-N-[[4-(trifluoromethyl)phenyl]-[3-(trifluoromethyl)-2-pyridinyl]methyl]benzamide |
|---|---|
| PubChem CID | 89310412 |
| Molecular Formula | C22H13F6N3O |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 2-cyano-N-[[4-(trifluoromethyl)phenyl]-[3-(trifluoromethyl)-2-pyridinyl]methyl]benzamide |
| SMILES | N#Cc1ccccc1C(=O)NC(c1ccc(C(F)(F)F)cc1)c1ncccc1C(F)(F)F |
| InChI | InChI=1S/C22H13F6N3O/c23-21(24,25)15-9-7-13(8-10-15)18(19-17(22(26,27)28)6-3-11-30-19)31-20(32)16-5-2-1-4-14(16)12-29/h1-11,18H,(H,31,32) |
| InChIKey | SFGIWQFQWGXULR-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |