C26H17F6N3O3 — CID 89310433
1,3-dioxo-2-prop-2-enyl-N-[[4-(trifluoromethyl)phenyl]-[3-(trifluoromethyl)-2-pyridinyl]methyl]isoindole-5-carboxamide (PubChem CID 89310433) has the molecular formula C26H17F6N3O3 and a molecular weight of 533.43 g/mol. Its IUPAC name is 1,3-dioxo-2-prop-2-enyl-N-[[4-(trifluoromethyl)phenyl]-[3-(trifluoromethyl)-2-pyridinyl]methyl]isoindole-5-carboxamide.
| Compound Name | 1,3-dioxo-2-prop-2-enyl-N-[[4-(trifluoromethyl)phenyl]-[3-(trifluoromethyl)-2-pyridinyl]methyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 89310433 |
| Molecular Formula | C26H17F6N3O3 |
| Molecular Weight | 533.43 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | 1,3-dioxo-2-prop-2-enyl-N-[[4-(trifluoromethyl)phenyl]-[3-(trifluoromethyl)-2-pyridinyl]methyl]isoindole-5-carboxamide |
| SMILES | C=CCN1C(=O)c2ccc(C(=O)NC(c3ccc(C(F)(F)F)cc3)c3ncccc3C(F)(F)F)cc2C1=O |
| InChI | InChI=1S/C26H17F6N3O3/c1-2-12-35-23(37)17-10-7-15(13-18(17)24(35)38)22(36)34-20(14-5-8-16(9-6-14)25(27,28)29)21-19(26(30,31)32)4-3-11-33-21/h2-11,13,20H,1,12H2,(H,34,36) |
| InChIKey | AVHJVDVKUABAKB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.43 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|