About sodium;acetic acid;methanidylbenzene
sodium;acetic acid;methanidylbenzene (PubChem CID 89310900) has the molecular formula C9H11NaO2
and a molecular weight of 174.17 g/mol. Its IUPAC name is sodium;acetic acid;methanidylbenzene.
Molecular Properties
| Compound Name | sodium;acetic acid;methanidylbenzene |
| PubChem CID | 89310900 |
| Molecular Formula | C9H11NaO2 |
| Molecular Weight | 174.17 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | sodium;acetic acid;methanidylbenzene |
| SMILES | CC(=O)O.[CH2-]c1ccccc1.[Na+] |
| InChI | InChI=1S/C7H7.C2H4O2.Na/c1-7-5-3-2-4-6-7;1-2(3)4;/h2-6H,1H2;1H3,(H,3,4);/q-1;;+1 |
| InChIKey | VYIQZKZKKDNDKI-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.17 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium;acetic acid;methanidylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;acetic acid;methanidylbenzene?
The IUPAC name of sodium;acetic acid;methanidylbenzene (CID 89310900) is sodium;acetic acid;methanidylbenzene.
What is the SMILES notation for sodium;acetic acid;methanidylbenzene?
The canonical SMILES for sodium;acetic acid;methanidylbenzene is CC(=O)O.[CH2-]c1ccccc1.[Na+].
What is the InChIKey of sodium;acetic acid;methanidylbenzene?
The InChIKey is VYIQZKZKKDNDKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7.C2H4O2.Na/c1-7-5-3-2-4-6-7;1-2(3)4;/h2-6H,1H2;1H3,(H,3,4);/q-1;;+1.
What are the key properties of sodium;acetic acid;methanidylbenzene?
sodium;acetic acid;methanidylbenzene has a molecular weight of 174.17 g/mol, XLogP of -1.04, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;acetic acid;methanidylbenzene is sourced from PubChem (CID 89310900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).