C13H23NO4 — CID 89312498
N-[2-(hydroxymethyl)-4-(2-methylbutan-2-yl)-3,7-dioxabicyclo[4.1.0]heptan-5-yl]acetamide (PubChem CID 89312498) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is N-[2-(hydroxymethyl)-4-(2-methylbutan-2-yl)-3,7-dioxabicyclo[4.1.0]heptan-5-yl]acetamide.
| Compound Name | N-[2-(hydroxymethyl)-4-(2-methylbutan-2-yl)-3,7-dioxabicyclo[4.1.0]heptan-5-yl]acetamide |
|---|---|
| PubChem CID | 89312498 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | N-[2-(hydroxymethyl)-4-(2-methylbutan-2-yl)-3,7-dioxabicyclo[4.1.0]heptan-5-yl]acetamide |
| SMILES | CCC(C)(C)C1OC(CO)C2OC2C1NC(C)=O |
| InChI | InChI=1S/C13H23NO4/c1-5-13(3,4)12-9(14-7(2)16)11-10(18-11)8(6-15)17-12/h8-12,15H,5-6H2,1-4H3,(H,14,16) |
| InChIKey | OMZBIDVXXUZLPY-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|