C22H21Cl2N5O5S — CID 89313566
(2S)-2-[[(5R)-5-[(4-aminophenyl)methyl]-7-(3,5-dichlorophenyl)-5-methyl-6-oxoimidazo[1,2-a]imidazol-3-yl]sulfonylamino]propanoic acid (PubChem CID 89313566) has the molecular formula C22H21Cl2N5O5S and a molecular weight of 538.41 g/mol. Its IUPAC name is (2S)-2-[[(5R)-5-[(4-aminophenyl)methyl]-7-(3,5-dichlorophenyl)-5-methyl-6-oxoimidazo[1,2-a]imidazol-3-yl]sulfonylamino]propanoic acid.
| Compound Name | (2S)-2-[[(5R)-5-[(4-aminophenyl)methyl]-7-(3,5-dichlorophenyl)-5-methyl-6-oxoimidazo[1,2-a]imidazol-3-yl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 89313566 |
| Molecular Formula | C22H21Cl2N5O5S |
| Molecular Weight | 538.41 g/mol |
| Exact Mass | 537.06 |
| IUPAC Name | (2S)-2-[[(5R)-5-[(4-aminophenyl)methyl]-7-(3,5-dichlorophenyl)-5-methyl-6-oxoimidazo[1,2-a]imidazol-3-yl]sulfonylamino]propanoic acid |
| SMILES | C[C@H](NS(=O)(=O)c1cnc2n1[C@](C)(Cc1ccc(N)cc1)C(=O)N2c1cc(Cl)cc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C22H21Cl2N5O5S/c1-12(19(30)31)27-35(33,34)18-11-26-21-28(17-8-14(23)7-15(24)9-17)20(32)22(2,29(18)21)10-13-3-5-16(25)6-4-13/h3-9,11-12,27H,10,25H2,1-2H3,(H,30,31)/t12-,22+/m0/s1 |
| InChIKey | JLRXGDCLXNQNLZ-AMXDTQDGSA-N |
| XLogP | 3.16 |
| TPSA | 147.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|