C8H14N2 — CID 89313734
N-ethyl-3-methyl-1,2-dihydropyridin-6-amine (PubChem CID 89313734) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is N-ethyl-3-methyl-1,2-dihydropyridin-6-amine.
| Compound Name | N-ethyl-3-methyl-1,2-dihydropyridin-6-amine |
|---|---|
| PubChem CID | 89313734 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | N-ethyl-3-methyl-1,2-dihydropyridin-6-amine |
| SMILES | CCNC1=CC=C(C)CN1 |
| InChI | InChI=1S/C8H14N2/c1-3-9-8-5-4-7(2)6-10-8/h4-5,9-10H,3,6H2,1-2H3 |
| InChIKey | BGUGSAJOQJBGJK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |