C28H25N5O3 — CID 89316347
4-[[9-amino-7-(2-propan-2-yloxyphenyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]benzoic acid (PubChem CID 89316347) has the molecular formula C28H25N5O3 and a molecular weight of 479.54 g/mol. Its IUPAC name is 4-[[9-amino-7-(2-propan-2-yloxyphenyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]benzoic acid.
| Compound Name | 4-[[9-amino-7-(2-propan-2-yloxyphenyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 89316347 |
| Molecular Formula | C28H25N5O3 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 4-[[9-amino-7-(2-propan-2-yloxyphenyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]benzoic acid |
| SMILES | CC(C)Oc1ccccc1C1=NCc2cnc(Nc3ccc(C(=O)O)cc3)nc2-c2ccc(N)cc21 |
| InChI | InChI=1S/C28H25N5O3/c1-16(2)36-24-6-4-3-5-22(24)26-23-13-19(29)9-12-21(23)25-18(14-30-26)15-31-28(33-25)32-20-10-7-17(8-11-20)27(34)35/h3-13,15-16H,14,29H2,1-2H3,(H,34,35)(H,31,32,33) |
| InChIKey | QBDKFUQVGIQLJH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|