C33H32FIN6O — CID 89339286
[4-(dimethylamino)piperidin-1-yl]-[4-[[7-(2-fluorophenyl)-9-(iodomethyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]phenyl]methanone (PubChem CID 89339286) has the molecular formula C33H32FIN6O and a molecular weight of 674.56 g/mol. Its IUPAC name is [4-(dimethylamino)piperidin-1-yl]-[4-[[7-(2-fluorophenyl)-9-(iodomethyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]phenyl]methanone.
| Compound Name | [4-(dimethylamino)piperidin-1-yl]-[4-[[7-(2-fluorophenyl)-9-(iodomethyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]phenyl]methanone |
|---|---|
| PubChem CID | 89339286 |
| Molecular Formula | C33H32FIN6O |
| Molecular Weight | 674.56 g/mol |
| Exact Mass | 674.17 |
| IUPAC Name | [4-(dimethylamino)piperidin-1-yl]-[4-[[7-(2-fluorophenyl)-9-(iodomethyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]phenyl]methanone |
| SMILES | CN(C)C1CCN(C(=O)c2ccc(Nc3ncc4c(n3)-c3ccc(CI)cc3C(c3ccccc3F)=NC4)cc2)CC1 |
| InChI | InChI=1S/C33H32FIN6O/c1-40(2)25-13-15-41(16-14-25)32(42)22-8-10-24(11-9-22)38-33-37-20-23-19-36-31(27-5-3-4-6-29(27)34)28-17-21(18-35)7-12-26(28)30(23)39-33/h3-12,17,20,25H,13-16,18-19H2,1-2H3,(H,37,38,39) |
| InChIKey | DDJDQFNIHQAXQD-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.56 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|