C31H28FIN6O — CID 89339311
[4-[[7-(3-fluorophenyl)-9-(iodomethyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]phenyl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 89339311) has the molecular formula C31H28FIN6O and a molecular weight of 646.51 g/mol. Its IUPAC name is [4-[[7-(3-fluorophenyl)-9-(iodomethyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]phenyl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [4-[[7-(3-fluorophenyl)-9-(iodomethyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]phenyl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 89339311 |
| Molecular Formula | C31H28FIN6O |
| Molecular Weight | 646.51 g/mol |
| Exact Mass | 646.14 |
| IUPAC Name | [4-[[7-(3-fluorophenyl)-9-(iodomethyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]phenyl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2ccc(Nc3ncc4c(n3)-c3ccc(CI)cc3C(c3cccc(F)c3)=NC4)cc2)CC1 |
| InChI | InChI=1S/C31H28FIN6O/c1-38-11-13-39(14-12-38)30(40)21-6-8-25(9-7-21)36-31-35-19-23-18-34-28(22-3-2-4-24(32)16-22)27-15-20(17-33)5-10-26(27)29(23)37-31/h2-10,15-16,19H,11-14,17-18H2,1H3,(H,35,36,37) |
| InChIKey | CCTOUDHZXBOKNS-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.51 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|