C24H17F2IN6OS — CID 89339376
2-[[7-(2,6-difluorophenyl)-9-(iodomethyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]-N-methyl-1,3-thiazole-4-carboxamide (PubChem CID 89339376) has the molecular formula C24H17F2IN6OS and a molecular weight of 602.41 g/mol. Its IUPAC name is 2-[[7-(2,6-difluorophenyl)-9-(iodomethyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]-N-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[[7-(2,6-difluorophenyl)-9-(iodomethyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]-N-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 89339376 |
| Molecular Formula | C24H17F2IN6OS |
| Molecular Weight | 602.41 g/mol |
| Exact Mass | 602.02 |
| IUPAC Name | 2-[[7-(2,6-difluorophenyl)-9-(iodomethyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]-N-methyl-1,3-thiazole-4-carboxamide |
| SMILES | CNC(=O)c1csc(Nc2ncc3c(n2)-c2ccc(CI)cc2C(c2c(F)cccc2F)=NC3)n1 |
| InChI | InChI=1S/C24H17F2IN6OS/c1-28-22(34)18-11-35-24(31-18)33-23-30-10-13-9-29-21(19-16(25)3-2-4-17(19)26)15-7-12(8-27)5-6-14(15)20(13)32-23/h2-7,10-11H,8-9H2,1H3,(H,28,34)(H,30,31,32,33) |
| InChIKey | FZPCKCDRDXSRQF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.41 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|