C27H20F2IN5O — CID 89339372
4-[[7-(2,6-difluorophenyl)-9-(iodomethyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]-N-methylbenzamide (PubChem CID 89339372) has the molecular formula C27H20F2IN5O and a molecular weight of 595.39 g/mol. Its IUPAC name is 4-[[7-(2,6-difluorophenyl)-9-(iodomethyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]-N-methylbenzamide.
| Compound Name | 4-[[7-(2,6-difluorophenyl)-9-(iodomethyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 89339372 |
| Molecular Formula | C27H20F2IN5O |
| Molecular Weight | 595.39 g/mol |
| Exact Mass | 595.07 |
| IUPAC Name | 4-[[7-(2,6-difluorophenyl)-9-(iodomethyl)-5H-pyrimido[5,4-d][2]benzazepin-2-yl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(Nc2ncc3c(n2)-c2ccc(CI)cc2C(c2c(F)cccc2F)=NC3)cc1 |
| InChI | InChI=1S/C27H20F2IN5O/c1-31-26(36)16-6-8-18(9-7-16)34-27-33-14-17-13-32-25(23-21(28)3-2-4-22(23)29)20-11-15(12-30)5-10-19(20)24(17)35-27/h2-11,14H,12-13H2,1H3,(H,31,36)(H,33,34,35) |
| InChIKey | XBJJGFSGBVCVJF-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.39 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|