C19H15N3O2S — CID 89316831
9-N-(3-ethynylphenyl)-3,3-dioxo-1,2-dihydrothieno[3,2-f]quinoline-8,9-diamine (PubChem CID 89316831) has the molecular formula C19H15N3O2S and a molecular weight of 349.42 g/mol. Its IUPAC name is 9-N-(3-ethynylphenyl)-3,3-dioxo-1,2-dihydrothieno[3,2-f]quinoline-8,9-diamine.
| Compound Name | 9-N-(3-ethynylphenyl)-3,3-dioxo-1,2-dihydrothieno[3,2-f]quinoline-8,9-diamine |
|---|---|
| PubChem CID | 89316831 |
| Molecular Formula | C19H15N3O2S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 9-N-(3-ethynylphenyl)-3,3-dioxo-1,2-dihydrothieno[3,2-f]quinoline-8,9-diamine |
| SMILES | C#Cc1cccc(Nc2c(N)cnc3ccc4c(c23)CCS4(=O)=O)c1 |
| InChI | InChI=1S/C19H15N3O2S/c1-2-12-4-3-5-13(10-12)22-19-15(20)11-21-16-6-7-17-14(18(16)19)8-9-25(17,23)24/h1,3-7,10-11H,8-9,20H2,(H,21,22) |
| InChIKey | XZRPBTCLECQAFP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|