C16H12F2N2O2S — CID 67468876
N-(2,5-difluorophenyl)-6-methylsulfonylquinolin-4-amine (PubChem CID 67468876) has the molecular formula C16H12F2N2O2S and a molecular weight of 334.35 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-6-methylsulfonylquinolin-4-amine.
| Compound Name | N-(2,5-difluorophenyl)-6-methylsulfonylquinolin-4-amine |
|---|---|
| PubChem CID | 67468876 |
| Molecular Formula | C16H12F2N2O2S |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | N-(2,5-difluorophenyl)-6-methylsulfonylquinolin-4-amine |
| SMILES | CS(=O)(=O)c1ccc2nccc(Nc3cc(F)ccc3F)c2c1 |
| InChI | InChI=1S/C16H12F2N2O2S/c1-23(21,22)11-3-5-14-12(9-11)15(6-7-19-14)20-16-8-10(17)2-4-13(16)18/h2-9H,1H3,(H,19,20) |
| InChIKey | RFNLKNDBLCMJNY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |