C29H45NO16S — CID 89318613
[(3S,5S,6R)-6-[(2S,4R,5R)-3-acetamido-2-(5-acetylsulfanylpentoxy)-5-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-3,4,5-triacetyloxyoxan-2-yl]methyl acetate (PubChem CID 89318613) has the molecular formula C29H45NO16S and a molecular weight of 695.74 g/mol. Its IUPAC name is [(3S,5S,6R)-6-[(2S,4R,5R)-3-acetamido-2-(5-acetylsulfanylpentoxy)-5-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-3,4,5-triacetyloxyoxan-2-yl]methyl acetate.
| Compound Name | [(3S,5S,6R)-6-[(2S,4R,5R)-3-acetamido-2-(5-acetylsulfanylpentoxy)-5-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 89318613 |
| Molecular Formula | C29H45NO16S |
| Molecular Weight | 695.74 g/mol |
| Exact Mass | 695.25 |
| IUPAC Name | [(3S,5S,6R)-6-[(2S,4R,5R)-3-acetamido-2-(5-acetylsulfanylpentoxy)-5-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)NC1[C@@H](OCCCCCSC(C)=O)OC(CO)[C@H](O)[C@@H]1O[C@@H]1OC(COC(C)=O)[C@H](OC(C)=O)C(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C29H45NO16S/c1-14(32)30-22-25(23(38)20(12-31)44-28(22)39-10-8-7-9-11-47-19(6)37)46-29-27(43-18(5)36)26(42-17(4)35)24(41-16(3)34)21(45-29)13-40-15(2)33/h20-29,31,38H,7-13H2,1-6H3,(H,30,32)/t20?,21?,22?,23-,24-,25+,26?,27-,28-,29-/m0/s1 |
| InChIKey | UGWKUUAJKRHUJA-MYLFZDBXSA-N |
| XLogP | -0.50 |
| TPSA | 228.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.74 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|