C24H24N2O4 — CID 89318847
(3E,4Z)-3-ethylidene-6-[1-[4-[(5-methyl-1,2-oxazol-3-yl)methoxy]-1-benzofuran-6-yl]ethenylamino]hepta-1,4,6-trien-2-ol (PubChem CID 89318847) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is (3E,4Z)-3-ethylidene-6-[1-[4-[(5-methyl-1,2-oxazol-3-yl)methoxy]-1-benzofuran-6-yl]ethenylamino]hepta-1,4,6-trien-2-ol.
| Compound Name | (3E,4Z)-3-ethylidene-6-[1-[4-[(5-methyl-1,2-oxazol-3-yl)methoxy]-1-benzofuran-6-yl]ethenylamino]hepta-1,4,6-trien-2-ol |
|---|---|
| PubChem CID | 89318847 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | (3E,4Z)-3-ethylidene-6-[1-[4-[(5-methyl-1,2-oxazol-3-yl)methoxy]-1-benzofuran-6-yl]ethenylamino]hepta-1,4,6-trien-2-ol |
| SMILES | C=C(/C=C\C(=C/C)C(=C)O)NC(=C)c1cc(OCc2cc(C)on2)c2ccoc2c1 |
| InChI | InChI=1S/C24H24N2O4/c1-6-19(18(5)27)8-7-15(2)25-17(4)20-12-23-22(9-10-28-23)24(13-20)29-14-21-11-16(3)30-26-21/h6-13,25,27H,2,4-5,14H2,1,3H3/b8-7-,19-6+ |
| InChIKey | YLWUGLRKSJUORN-YARRYIBXSA-N |
| XLogP | 5.96 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|