C19H19FO2 — CID 89319085
4-[(1E)-3-ethoxybuta-1,3-dienyl]-2-fluoro-1-phenylmethoxybenzene (PubChem CID 89319085) has the molecular formula C19H19FO2 and a molecular weight of 298.36 g/mol. Its IUPAC name is 4-[(1E)-3-ethoxybuta-1,3-dienyl]-2-fluoro-1-phenylmethoxybenzene.
| Compound Name | 4-[(1E)-3-ethoxybuta-1,3-dienyl]-2-fluoro-1-phenylmethoxybenzene |
|---|---|
| PubChem CID | 89319085 |
| Molecular Formula | C19H19FO2 |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 4-[(1E)-3-ethoxybuta-1,3-dienyl]-2-fluoro-1-phenylmethoxybenzene |
| SMILES | C=C(/C=C/c1ccc(OCc2ccccc2)c(F)c1)OCC |
| InChI | InChI=1S/C19H19FO2/c1-3-21-15(2)9-10-16-11-12-19(18(20)13-16)22-14-17-7-5-4-6-8-17/h4-13H,2-3,14H2,1H3/b10-9+ |
| InChIKey | VUCCATITWOXCAZ-MDZDMXLPSA-N |
| XLogP | 4.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|