C23H28BrN3O4 — CID 89319553
5-amino-1-[(5-bromo-2,3-dimethoxyphenyl)methyl]-N-(3-hydroxy-2,2-dimethylpropyl)indole-2-carboxamide (PubChem CID 89319553) has the molecular formula C23H28BrN3O4 and a molecular weight of 490.40 g/mol. Its IUPAC name is 5-amino-1-[(5-bromo-2,3-dimethoxyphenyl)methyl]-N-(3-hydroxy-2,2-dimethylpropyl)indole-2-carboxamide.
| Compound Name | 5-amino-1-[(5-bromo-2,3-dimethoxyphenyl)methyl]-N-(3-hydroxy-2,2-dimethylpropyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 89319553 |
| Molecular Formula | C23H28BrN3O4 |
| Molecular Weight | 490.40 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 5-amino-1-[(5-bromo-2,3-dimethoxyphenyl)methyl]-N-(3-hydroxy-2,2-dimethylpropyl)indole-2-carboxamide |
| SMILES | COc1cc(Br)cc(Cn2c(C(=O)NCC(C)(C)CO)cc3cc(N)ccc32)c1OC |
| InChI | InChI=1S/C23H28BrN3O4/c1-23(2,13-28)12-26-22(29)19-9-14-8-17(25)5-6-18(14)27(19)11-15-7-16(24)10-20(30-3)21(15)31-4/h5-10,28H,11-13,25H2,1-4H3,(H,26,29) |
| InChIKey | IWUQQXRKYFGFJC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|