C25H16N2O3 — CID 89321859
4-hydroxy-3-(1H-quinolin-2-ylidenemethylidene)-5-(quinolin-2-ylmethylidene)cyclopentane-1,2-dione (PubChem CID 89321859) has the molecular formula C25H16N2O3 and a molecular weight of 392.41 g/mol. Its IUPAC name is 4-hydroxy-3-(1H-quinolin-2-ylidenemethylidene)-5-(quinolin-2-ylmethylidene)cyclopentane-1,2-dione.
| Compound Name | 4-hydroxy-3-(1H-quinolin-2-ylidenemethylidene)-5-(quinolin-2-ylmethylidene)cyclopentane-1,2-dione |
|---|---|
| PubChem CID | 89321859 |
| Molecular Formula | C25H16N2O3 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 4-hydroxy-3-(1H-quinolin-2-ylidenemethylidene)-5-(quinolin-2-ylmethylidene)cyclopentane-1,2-dione |
| SMILES | O=C1C(=O)C(=Cc2ccc3ccccc3n2)C(O)C1=C=C1C=Cc2ccccc2N1 |
| InChI | InChI=1S/C25H16N2O3/c28-23-19(13-17-11-9-15-5-1-3-7-21(15)26-17)24(29)25(30)20(23)14-18-12-10-16-6-2-4-8-22(16)27-18/h1-13,23,27-28H |
| InChIKey | YKQRWSLDBHLPQJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|