C24H21ClN2O2 — CID 89322223
phenyl 6-chloro-1-cyclohexa-1,3-dien-1-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 89322223) has the molecular formula C24H21ClN2O2 and a molecular weight of 404.90 g/mol. Its IUPAC name is phenyl 6-chloro-1-cyclohexa-1,3-dien-1-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | phenyl 6-chloro-1-cyclohexa-1,3-dien-1-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 89322223 |
| Molecular Formula | C24H21ClN2O2 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | phenyl 6-chloro-1-cyclohexa-1,3-dien-1-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | O=C(Oc1ccccc1)N1CCc2c([nH]c3ccc(Cl)cc23)C1C1=CC=CCC1 |
| InChI | InChI=1S/C24H21ClN2O2/c25-17-11-12-21-20(15-17)19-13-14-27(24(28)29-18-9-5-2-6-10-18)23(22(19)26-21)16-7-3-1-4-8-16/h1-3,5-7,9-12,15,23,26H,4,8,13-14H2 |
| InChIKey | JOZGDEUWWHLNMO-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|