C29H20Cl3N2O3- — CID 90993501
(4-chlorophenyl) 6-chloro-1-[4-(4-chlorocyclopenta-1,4-dien-1-yl)oxyphenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 90993501) has the molecular formula C29H20Cl3N2O3- and a molecular weight of 550.85 g/mol. Its IUPAC name is (4-chlorophenyl) 6-chloro-1-[4-(4-chlorocyclopenta-1,4-dien-1-yl)oxyphenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-chlorophenyl) 6-chloro-1-[4-(4-chlorocyclopenta-1,4-dien-1-yl)oxyphenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 90993501 |
| Molecular Formula | C29H20Cl3N2O3- |
| Molecular Weight | 550.85 g/mol |
| Exact Mass | 549.05 |
| IUPAC Name | (4-chlorophenyl) 6-chloro-1-[4-(4-chlorocyclopenta-1,4-dien-1-yl)oxyphenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | O=C(Oc1ccc(Cl)cc1)N1CCc2c([nH]c3ccc(Cl)cc23)C1c1ccc(Oc2c[cH-]c(Cl)c2)cc1 |
| InChI | InChI=1S/C29H20Cl3N2O3/c30-18-3-9-22(10-4-18)37-29(35)34-14-13-24-25-16-20(32)6-12-26(25)33-27(24)28(34)17-1-7-21(8-2-17)36-23-11-5-19(31)15-23/h1-12,15-16,28,33H,13-14H2/q-1 |
| InChIKey | RHECHRFDBYAHPM-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.85 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|