C29H23Cl2N3O5S2 — CID 75299416
(4-chlorophenyl) 6-chloro-1-[4-[[5-(methylsulfonylmethyl)-1,3-thiazol-2-yl]oxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 75299416) has the molecular formula C29H23Cl2N3O5S2 and a molecular weight of 628.56 g/mol. Its IUPAC name is (4-chlorophenyl) 6-chloro-1-[4-[[5-(methylsulfonylmethyl)-1,3-thiazol-2-yl]oxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-chlorophenyl) 6-chloro-1-[4-[[5-(methylsulfonylmethyl)-1,3-thiazol-2-yl]oxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 75299416 |
| Molecular Formula | C29H23Cl2N3O5S2 |
| Molecular Weight | 628.56 g/mol |
| Exact Mass | 627.05 |
| IUPAC Name | (4-chlorophenyl) 6-chloro-1-[4-[[5-(methylsulfonylmethyl)-1,3-thiazol-2-yl]oxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CS(=O)(=O)Cc1cnc(Oc2ccc(C3c4[nH]c5ccc(Cl)cc5c4CCN3C(=O)Oc3ccc(Cl)cc3)cc2)s1 |
| InChI | InChI=1S/C29H23Cl2N3O5S2/c1-41(36,37)16-22-15-32-28(40-22)38-20-7-2-17(3-8-20)27-26-23(24-14-19(31)6-11-25(24)33-26)12-13-34(27)29(35)39-21-9-4-18(30)5-10-21/h2-11,14-15,27,33H,12-13,16H2,1H3 |
| InChIKey | IIKQGRWBQXQGJP-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 101.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.56 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|