C33H31Cl2N5O3S — CID 67986194
(4-chlorophenyl) (1S)-6-chloro-1-[4-[[5-[(4-methylpiperazin-1-yl)methyl]-1,3-thiazol-2-yl]oxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 67986194) has the molecular formula C33H31Cl2N5O3S and a molecular weight of 648.62 g/mol. Its IUPAC name is (4-chlorophenyl) (1S)-6-chloro-1-[4-[[5-[(4-methylpiperazin-1-yl)methyl]-1,3-thiazol-2-yl]oxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-chlorophenyl) (1S)-6-chloro-1-[4-[[5-[(4-methylpiperazin-1-yl)methyl]-1,3-thiazol-2-yl]oxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 67986194 |
| Molecular Formula | C33H31Cl2N5O3S |
| Molecular Weight | 648.62 g/mol |
| Exact Mass | 647.15 |
| IUPAC Name | (4-chlorophenyl) (1S)-6-chloro-1-[4-[[5-[(4-methylpiperazin-1-yl)methyl]-1,3-thiazol-2-yl]oxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CN1CCN(Cc2cnc(Oc3ccc([C@H]4c5[nH]c6ccc(Cl)cc6c5CCN4C(=O)Oc4ccc(Cl)cc4)cc3)s2)CC1 |
| InChI | InChI=1S/C33H31Cl2N5O3S/c1-38-14-16-39(17-15-38)20-26-19-36-32(44-26)42-24-7-2-21(3-8-24)31-30-27(28-18-23(35)6-11-29(28)37-30)12-13-40(31)33(41)43-25-9-4-22(34)5-10-25/h2-11,18-19,31,37H,12-17,20H2,1H3/t31-/m0/s1 |
| InChIKey | NZENBOZEQJJTDL-HKBQPEDESA-N |
| XLogP | 7.62 |
| TPSA | 73.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.62 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|