C15H18IN3O2 — CID 89323620
[2-(iodomethyl)-6-[2-(4-methoxyphenyl)ethylamino]pyrimidin-4-yl]methanol (PubChem CID 89323620) has the molecular formula C15H18IN3O2 and a molecular weight of 399.23 g/mol. Its IUPAC name is [2-(iodomethyl)-6-[2-(4-methoxyphenyl)ethylamino]pyrimidin-4-yl]methanol.
| Compound Name | [2-(iodomethyl)-6-[2-(4-methoxyphenyl)ethylamino]pyrimidin-4-yl]methanol |
|---|---|
| PubChem CID | 89323620 |
| Molecular Formula | C15H18IN3O2 |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | [2-(iodomethyl)-6-[2-(4-methoxyphenyl)ethylamino]pyrimidin-4-yl]methanol |
| SMILES | COc1ccc(CCNc2cc(CO)nc(CI)n2)cc1 |
| InChI | InChI=1S/C15H18IN3O2/c1-21-13-4-2-11(3-5-13)6-7-17-14-8-12(10-20)18-15(9-16)19-14/h2-5,8,20H,6-7,9-10H2,1H3,(H,17,18,19) |
| InChIKey | MPXDTDWZEMOTMJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|