C27H36N5OS+ — CID 89324156
(Z)-[(Z)-3-aminoprop-2-enylidene]-methyl-[1-[3-[4-[4-[(E)-2-(1-methyl-2H-pyridin-4-yl)ethenyl]phenyl]piperazin-1-yl]-3-oxopropyl]sulfanylethenyl]azanium (PubChem CID 89324156) has the molecular formula C27H36N5OS+ and a molecular weight of 478.69 g/mol. Its IUPAC name is (Z)-[(Z)-3-aminoprop-2-enylidene]-methyl-[1-[3-[4-[4-[(E)-2-(1-methyl-2H-pyridin-4-yl)ethenyl]phenyl]piperazin-1-yl]-3-oxopropyl]sulfanylethenyl]azanium.
| Compound Name | (Z)-[(Z)-3-aminoprop-2-enylidene]-methyl-[1-[3-[4-[4-[(E)-2-(1-methyl-2H-pyridin-4-yl)ethenyl]phenyl]piperazin-1-yl]-3-oxopropyl]sulfanylethenyl]azanium |
|---|---|
| PubChem CID | 89324156 |
| Molecular Formula | C27H36N5OS+ |
| Molecular Weight | 478.69 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | (Z)-[(Z)-3-aminoprop-2-enylidene]-methyl-[1-[3-[4-[4-[(E)-2-(1-methyl-2H-pyridin-4-yl)ethenyl]phenyl]piperazin-1-yl]-3-oxopropyl]sulfanylethenyl]azanium |
| SMILES | C=C(SCCC(=O)N1CCN(c2ccc(/C=C/C3=CCN(C)C=C3)cc2)CC1)/[N+](C)=C\C=C/N |
| InChI | InChI=1S/C27H35N5OS/c1-23(30(3)15-4-14-28)34-22-13-27(33)32-20-18-31(19-21-32)26-9-7-24(8-10-26)5-6-25-11-16-29(2)17-12-25/h4-12,14-16,28H,1,13,17-22H2,2-3H3/p+1/b6-5+ |
| InChIKey | HACUYGIEJMQURJ-AATRIKPKSA-O |
| XLogP | 3.51 |
| TPSA | 55.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.69 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|