C26H31N5OS+2 — CID 143546417
1-[4-[4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl]piperazin-1-yl]-3-(1-methylpyrimidin-1-ium-2-yl)sulfanylpropan-1-one (PubChem CID 143546417) has the molecular formula C26H31N5OS+2 and a molecular weight of 461.64 g/mol. Its IUPAC name is 1-[4-[4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl]piperazin-1-yl]-3-(1-methylpyrimidin-1-ium-2-yl)sulfanylpropan-1-one.
| Compound Name | 1-[4-[4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl]piperazin-1-yl]-3-(1-methylpyrimidin-1-ium-2-yl)sulfanylpropan-1-one |
|---|---|
| PubChem CID | 143546417 |
| Molecular Formula | C26H31N5OS+2 |
| Molecular Weight | 461.64 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 1-[4-[4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl]piperazin-1-yl]-3-(1-methylpyrimidin-1-ium-2-yl)sulfanylpropan-1-one |
| SMILES | C[n+]1ccc(/C=C/c2ccc(N3CCN(C(=O)CCSc4nccc[n+]4C)CC3)cc2)cc1 |
| InChI | InChI=1S/C26H31N5OS/c1-28-15-10-23(11-16-28)5-4-22-6-8-24(9-7-22)30-17-19-31(20-18-30)25(32)12-21-33-26-27-13-3-14-29(26)2/h3-11,13-16H,12,17-21H2,1-2H3/q+2 |
| InChIKey | FHCKUTKLNMCNND-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 44.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.64 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|