C40H52N6S2+2 — CID 88591541
1-[4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl]-4-[2-[2-[4-[4-[2-(1-methylpyridin-1-ium-4-yl)ethyl]phenyl]piperazin-1-yl]ethyldisulfanyl]ethyl]piperazine (PubChem CID 88591541) has the molecular formula C40H52N6S2+2 and a molecular weight of 681.03 g/mol. Its IUPAC name is 1-[4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl]-4-[2-[2-[4-[4-[2-(1-methylpyridin-1-ium-4-yl)ethyl]phenyl]piperazin-1-yl]ethyldisulfanyl]ethyl]piperazine.
| Compound Name | 1-[4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl]-4-[2-[2-[4-[4-[2-(1-methylpyridin-1-ium-4-yl)ethyl]phenyl]piperazin-1-yl]ethyldisulfanyl]ethyl]piperazine |
|---|---|
| PubChem CID | 88591541 |
| Molecular Formula | C40H52N6S2+2 |
| Molecular Weight | 681.03 g/mol |
| Exact Mass | 680.37 |
| IUPAC Name | 1-[4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]phenyl]-4-[2-[2-[4-[4-[2-(1-methylpyridin-1-ium-4-yl)ethyl]phenyl]piperazin-1-yl]ethyldisulfanyl]ethyl]piperazine |
| SMILES | C[n+]1ccc(/C=C/c2ccc(N3CCN(CCSSCCN4CCN(c5ccc(CCc6cc[n+](C)cc6)cc5)CC4)CC3)cc2)cc1 |
| InChI | InChI=1S/C40H52N6S2/c1-41-19-15-37(16-20-41)5-3-35-7-11-39(12-8-35)45-27-23-43(24-28-45)31-33-47-48-34-32-44-25-29-46(30-26-44)40-13-9-36(10-14-40)4-6-38-17-21-42(2)22-18-38/h3,5,7-22H,4,6,23-34H2,1-2H3/q+2 |
| InChIKey | ZJUYVKNCEIUFDU-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 20.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.03 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|